qb7kcbq728 qb7kcbq728
  • 04-03-2021
  • Mathematics
contestada

What is the inverse function of f(x) =x/ x-2

What is the inverse function of fx x x2 class=

Respuesta :

Аноним Аноним
  • 04-03-2021

Answer:

f^-1(x)=2x/x-1

Step-by-step explanation:

Answer Link
ajzwoot
ajzwoot ajzwoot
  • 04-03-2021

Answer:

f-1(x) = 2x/x-1

Step-by-step explanation:

Bottom left

I checked my work with Chegg

Answer Link

Otras preguntas

The lender is a secured or unsecured loan
On a math test, the students are asked to find the perimeter of rectangle STUV with vertices S(-6.5, -8.5), T(2.5, -8.5), U(2.5, 3.5), and V-6.5, 3.5). Alberto
Vhat is the solution to the following system? 3x+10y- 12z = 40 X-5y = 0 X-4z = 0
I need help someone PLEASE
I WILL GIVE BRAINLIEST A student was asked to find the square of 7x + 3. The student quickly wrote (7x + 3)2 = 49x2 + 9. Identify the student's error and provi
Explain how the power of the Court is balanced or limited.
what are the primary curvatures of the spine and how are they shaped
Solve for p. -1 + 5p = -10 + 4p
cosec(6b+pi/8)=sec(2b-pi/8)​
How are reactants converted to products in an elementary reaction?